Difference between revisions of "ADENOSYL-HOMO-CYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * molecular-weight: ** 1025.937 * inchi-key: ** reoymonhghuley-ppsvnwdxsa-j * smi...")
(Created page with "Category:metabolite == Metabolite ADENOSYL-HOMO-CYS == * common-name: ** s-adenosyl-l-homocysteine * molecular-weight: ** 384.409 * inchi-key: ** zjuktbdsgofhsh-wfmpwkqpsa...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-19172 ==
+
== Metabolite ADENOSYL-HOMO-CYS ==
 
* common-name:
 
* common-name:
−
** (2e,9z)-octadecenoyl-coa
+
** s-adenosyl-l-homocysteine
 
* molecular-weight:
 
* molecular-weight:
−
** 1025.937
+
** 384.409
 
* inchi-key:
 
* inchi-key:
−
** reoymonhghuley-ppsvnwdxsa-j
+
** zjuktbdsgofhsh-wfmpwkqpsa-n
 
* smiles:
 
* smiles:
−
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17776]]
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.1.1.100-RXN]]
 +
* [[2.1.1.125-RXN]]
 +
* [[2.1.1.126-RXN]]
 +
* [[2.1.1.135-RXN]]
 +
* [[2.1.1.137-RXN]]
 +
* [[2.1.1.138-RXN]]
 +
* [[2.1.1.34-RXN]]
 +
* [[2.1.1.57-RXN]]
 +
* [[2.1.1.77-RXN]]
 +
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 +
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 +
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
 +
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[RXN-11263]]
 +
* [[RXN-11370]]
 +
* [[RXN-11373]]
 +
* [[RXN-11374]]
 +
* [[RXN-11574]]
 +
* [[RXN-11576]]
 +
* [[RXN-11635]]
 +
* [[RXN-13403]]
 +
* [[RXN-13406]]
 +
* [[RXN-14177]]
 +
* [[RXN-14326]]
 +
* [[RXN-2542]]
 +
* [[RXN-2562]]
 +
* [[RXN-4021]]
 +
* [[RXN-5642]]
 +
* [[RXN-6723]]
 +
* [[RXN-7569]]
 +
* [[RXN-7605]]
 +
* [[RXN-8675]]
 +
* [[RXN-8761]]
 +
* [[RXN-8764]]
 +
* [[RXN-8766]]
 +
* [[RXN-8767]]
 +
* [[RXN0-6515]]
 +
* [[RXN1G-2527]]
 +
* [[RXN1G-2544]]
 +
* [[RXN1G-3232]]
 +
* [[RXN1G-3256]]
 +
* [[RXN1G-3613]]
 +
* [[RXN1G-3641]]
 +
* [[RXN1G-45]]
 +
* [[RXN3O-178]]
 +
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 +
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 +
* [[UROPORIIIMETHYLTRANSA-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
+
{{#set: common-name=s-adenosyl-l-homocysteine}}
−
{{#set: molecular-weight=1025.937}}
+
{{#set: molecular-weight=384.409}}
−
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
+
{{#set: inchi-key=inchikey=zjuktbdsgofhsh-wfmpwkqpsa-n}}

Latest revision as of 19:37, 17 March 2021

Metabolite ADENOSYL-HOMO-CYS

  • common-name:
    • s-adenosyl-l-homocysteine
  • molecular-weight:
    • 384.409
  • inchi-key:
    • zjuktbdsgofhsh-wfmpwkqpsa-n
  • smiles:
    • c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=ADENOSYL-HOMO-CYS&oldid=50344"