Difference between revisions of "ALPHA-D-MANNOSYLCHITOBIO"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-118 == * common-name: ** α-carotene * molecular-weight: ** 536.882 * inchi-key: ** anvaowxlwrtkga-ntxluargsa-n * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite ALPHA-D-MANNOSYLCHITOBIO == * common-name: ** β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol == Re...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-118 ==
+
== Metabolite ALPHA-D-MANNOSYLCHITOBIO ==
 
* common-name:
 
* common-name:
** α-carotene
+
** β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol
* molecular-weight:
 
** 536.882
 
* inchi-key:
 
** anvaowxlwrtkga-ntxluargsa-n
 
* smiles:
 
** cc(c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))=cc=cc=c(c)c=cc=c(c)c=cc2(c(c)(c)cccc(c)=2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-5462]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-148]]
+
* [[2.4.1.142-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-carotene}}
+
{{#set: common-name=β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol}}
{{#set: molecular-weight=536.882}}
 
{{#set: inchi-key=inchikey=anvaowxlwrtkga-ntxluargsa-n}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite ALPHA-D-MANNOSYLCHITOBIO

  • common-name:
    • β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality