Difference between revisions of "Acetoacetyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * molecular-weight: ** 187.19 * inchi-key: ** wgnakzgusrvwrh-uhfffaoysa-m * smiles:...")
(Created page with "Category:metabolite == Metabolite Acetoacetyl-ACPs == * common-name: ** an acetoacetyl-[acp] == Reaction(s) known to consume the compound == * RXN-9514 == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16819 ==
+
== Metabolite Acetoacetyl-ACPs ==
 
* common-name:
 
* common-name:
** 4-methylphenyl sulfate
+
** an acetoacetyl-[acp]
* molecular-weight:
 
** 187.19
 
* inchi-key:
 
** wgnakzgusrvwrh-uhfffaoysa-m
 
* smiles:
 
** cc1(c=cc(=cc=1)os(=o)(=o)[o-])
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15588]]
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylphenyl sulfate}}
+
{{#set: common-name=an acetoacetyl-[acp]}}
{{#set: molecular-weight=187.19}}
 
{{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Acetoacetyl-ACPs

  • common-name:
    • an acetoacetyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an acetoacetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.