Difference between revisions of "Acyl-protein-synthetase"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * molecular-weight: ** 650.978 * inchi-key: ** auyycjsjgjycds-lbprgkrzsa-n *...")
(Created page with "Category:metabolite == Metabolite Acyl-protein-synthetase == * common-name: ** a [luxe]-l-cysteine == Reaction(s) known to consume the compound == == Reaction(s) known to...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LIOTHYRONINE ==
+
== Metabolite Acyl-protein-synthetase ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine
+
** a [luxe]-l-cysteine
* molecular-weight:
 
** 650.978
 
* inchi-key:
 
** auyycjsjgjycds-lbprgkrzsa-n
 
* smiles:
 
** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10607]]
 
* [[RXN-10609]]
 
* [[RXN-10615]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17107]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
+
{{#set: common-name=a [luxe]-l-cysteine}}
{{#set: molecular-weight=650.978}}
 
{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Acyl-protein-synthetase

  • common-name:
    • a [luxe]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [luxe]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.