Difference between revisions of "Aliphatic-L-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** rnbgygvwrk...")
(Created page with "Category:metabolite == Metabolite Aliphatic-L-Amino-Acids == * common-name: ** an aliphatic l-amino acid == Reaction(s) known to consume the compound == == Reaction(s) kno...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
+
== Metabolite Aliphatic-L-Amino-Acids ==
 
* common-name:
 
* common-name:
** β-d-fructose 1,6-bisphosphate
+
** an aliphatic l-amino acid
* molecular-weight:
 
** 336.085
 
* inchi-key:
 
** rnbgygvwrkecfj-arqdhwqxsa-j
 
* smiles:
 
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
 
* [[F16ALDOLASE-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
+
* [[AMINOACYLASE-RXN]]
* [[6PFRUCTPHOS-RXN]]
 
* [[F16ALDOLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
+
{{#set: common-name=an aliphatic l-amino acid}}
{{#set: molecular-weight=336.085}}
 
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Aliphatic-L-Amino-Acids

  • common-name:
    • an aliphatic l-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality