Difference between revisions of "All-trans-Retinyl-Esters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ENOL-PHENYLPYRUVATE == * common-name: ** enol-phenylpyruvate * molecular-weight: ** 163.152 * inchi-key: ** dedgugjnlnljsr-vurmdhgxsa-m *...")
(Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-12575...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ENOL-PHENYLPYRUVATE ==
+
== Metabolite All-trans-Retinyl-Esters ==
 
* common-name:
 
* common-name:
** enol-phenylpyruvate
+
** an all-trans-retinyl ester
* molecular-weight:
 
** 163.152
 
* inchi-key:
 
** dedgugjnlnljsr-vurmdhgxsa-m
 
* smiles:
 
** c([o-])(=o)c(o)=cc1(c=cc=cc=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12575]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHENYLPYRUVATE-TAUTOMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=enol-phenylpyruvate}}
+
{{#set: common-name=an all-trans-retinyl ester}}
{{#set: molecular-weight=163.152}}
 
{{#set: inchi-key=inchikey=dedgugjnlnljsr-vurmdhgxsa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite All-trans-Retinyl-Esters

  • common-name:
    • an all-trans-retinyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality