Difference between revisions of "Apo-EntB"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * molecular-weight: ** 136.13 * inchi-key: ** alynczndiqevrv-uhfffaoysa-m * smiles:...")
(Created page with "Category:metabolite == Metabolite Apo-EntB == * common-name: ** an apo-[entb aryl-carrier protein] == Reaction(s) known to consume the compound == * ENTDB-RXN == React...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P-AMINO-BENZOATE ==
+
== Metabolite Apo-EntB ==
 
* common-name:
 
* common-name:
** 4-aminobenzoate
+
** an apo-[entb aryl-carrier protein]
* molecular-weight:
 
** 136.13
 
* inchi-key:
 
** alynczndiqevrv-uhfffaoysa-m
 
* smiles:
 
** c(=o)([o-])c1(c=cc(=cc=1)n)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2PTEROATESYNTH-RXN]]
+
* [[ENTDB-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADCLY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-aminobenzoate}}
+
{{#set: common-name=an apo-[entb aryl-carrier protein]}}
{{#set: molecular-weight=136.13}}
 
{{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Apo-EntB

  • common-name:
    • an apo-[entb aryl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[entb aryl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.