Difference between revisions of "CO-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19010 == * common-name: ** 1,2-epoxy-2-methylpropane * molecular-weight: ** 72.107 * inchi-key: ** gelkghvafrcjna-uhfffaoysa-n * smil...")
(Created page with "Category:metabolite == Metabolite CO-A == * common-name: ** coenzyme a * molecular-weight: ** 763.502 * inchi-key: ** rgjoekwqdubaiz-ibosznhhsa-j * smiles: ** cc(c)(c(o)c(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19010 ==
+
== Metabolite CO-A ==
 
* common-name:
 
* common-name:
** 1,2-epoxy-2-methylpropane
+
** coenzyme a
 
* molecular-weight:
 
* molecular-weight:
** 72.107
+
** 763.502
 
* inchi-key:
 
* inchi-key:
** gelkghvafrcjna-uhfffaoysa-n
+
** rgjoekwqdubaiz-ibosznhhsa-j
 
* smiles:
 
* smiles:
** cc1(c)(oc1)
+
** cc(c)(c(o)c(=o)nccc(=o)nccs)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17589]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.34-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[1.2.1.25-RXN]]
 +
* [[1.2.1.27-RXN]]
 +
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 +
* [[2.3.1.155-RXN]]
 +
* [[2.3.1.168-RXN]]
 +
* [[2.3.1.176-RXN]]
 +
* [[2.3.1.23-RXN]]
 +
* [[2.3.1.67-RXN]]
 +
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
 +
* [[4-COUMARATE--COA-LIGASE-RXN]]
 +
* [[6.2.1.34-RXN]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ACYLCOASYN-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ENTDB-RXN]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
* [[KETOBUTFORMLY-RXN]]
 +
* [[LINOLENOYL-RXN]]
 +
* [[MBCOA-DHLIPOAMIDE-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[PEPTIDE-ALPHA-N-ACETYLTRANSFERASE-RXN]]
 +
* [[PHYTANATE--COA-LIGASE-RXN]]
 +
* [[PYRUVDEH-RXN]]
 +
* [[R08190]]
 +
* [[R223-RXN]]
 +
* [[R7-RXN]]
 +
* [[RXN-10699]]
 +
* [[RXN-10700]]
 +
* [[RXN-10701]]
 +
* [[RXN-10919]]
 +
* [[RXN-10994]]
 +
* [[RXN-11213]]
 +
* [[RXN-1124]]
 +
* [[RXN-11246]]
 +
* [[RXN-1126]]
 +
* [[RXN-11917]]
 +
* [[RXN-11921]]
 +
* [[RXN-12184]]
 +
* [[RXN-12561]]
 +
* [[RXN-12565]]
 +
* [[RXN-12710]]
 +
* [[RXN-12978]]
 +
* [[RXN-13290]]
 +
* [[RXN-13614]]
 +
* [[RXN-13617]]
 +
* [[RXN-14268]]
 +
* [[RXN-14274]]
 +
* [[RXN-14277]]
 +
* [[RXN-14394]]
 +
* [[RXN-14774]]
 +
* [[RXN-14788]]
 +
* [[RXN-14793]]
 +
* [[RXN-14799]]
 +
* [[RXN-14803]]
 +
* [[RXN-15036]]
 +
* [[RXN-15066]]
 +
* [[RXN-15889]]
 +
* [[RXN-16041]]
 +
* [[RXN-16043]]
 +
* [[RXN-16045]]
 +
* [[RXN-16103]]
 +
* [[RXN-16137]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-16380]]
 +
* [[RXN-16389]]
 +
* [[RXN-16393]]
 +
* [[RXN-16401]]
 +
* [[RXN-16402]]
 +
* [[RXN-16415]]
 +
* [[RXN-16418]]
 +
* [[RXN-16561]]
 +
* [[RXN-16759]]
 +
* [[RXN-17116]]
 +
* [[RXN-17688]]
 +
* [[RXN-17778]]
 +
* [[RXN-17782]]
 +
* [[RXN-17787]]
 +
* [[RXN-17791]]
 +
* [[RXN-17795]]
 +
* [[RXN-17799]]
 +
* [[RXN-2001]]
 +
* [[RXN-2006]]
 +
* [[RXN-2902]]
 +
* [[RXN-5181]]
 +
* [[RXN-7904]]
 +
* [[RXN-8032]]
 +
* [[RXN-8988]]
 +
* [[RXN-9623]]
 +
* [[RXN-9644]]
 +
* [[RXN-9670]]
 +
* [[RXN-9673]]
 +
* [[RXN-9958]]
 +
* [[RXN0-1133]]
 +
* [[RXN0-1147]]
 +
* [[RXN0-7238]]
 +
* [[RXN0-7239]]
 +
* [[RXN0-7248]]
 +
* [[RXN1G-460]]
 +
* [[RXN3O-5304]]
 +
* [[RXN3O-9780]]
 +
* [[RXN66-469]]
 +
* [[RXN66-474]]
 +
* [[RXN66-477]]
 +
* [[RXN66-480]]
 +
* [[RXN66-483]]
 +
* [[RXN66-484]]
 +
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[TRANS-RXN0-623]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.34-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[2-ISOPROPYLMALATESYN-RXN]]
 +
* [[2.3.1.168-RXN]]
 +
* [[2.3.1.23-RXN]]
 +
* [[2.3.1.67-RXN]]
 +
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
 +
* [[7KAPSYN-RXN]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ACYL-COA-HYDROLASE-RXN]]
 +
* [[CITSYN-RXN]]
 +
* [[DEPHOSPHOCOAKIN-RXN]]
 +
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 +
* [[DIHYDLIPACETRANS-RXN]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[GLUCOSAMINEPNACETYLTRANS-RXN]]
 +
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 +
* [[HOMSUCTRAN-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
 +
* [[LINOLEOYL-RXN]]
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[MALSYN-RXN]]
 +
* [[MBCOA-DHLIPOAMIDE-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 +
* [[PEPTIDE-ALPHA-N-ACETYLTRANSFERASE-RXN]]
 +
* [[R08184]]
 +
* [[R08190]]
 +
* [[RXN-10059]]
 +
* [[RXN-10662]]
 +
* [[RXN-10708]]
 +
* [[RXN-10734]]
 +
* [[RXN-10994]]
 +
* [[RXN-1101]]
 +
* [[RXN-1106]]
 +
* [[RXN-1124]]
 +
* [[RXN-12565]]
 +
* [[RXN-13295]]
 +
* [[RXN-13431]]
 +
* [[RXN-13435]]
 +
* [[RXN-13442]]
 +
* [[RXN-1381]]
 +
* [[RXN-14554]]
 +
* [[RXN-15036]]
 +
* [[RXN-15043]]
 +
* [[RXN-15044]]
 +
* [[RXN-15045]]
 +
* [[RXN-15066]]
 +
* [[RXN-16016]]
 +
* [[RXN-16042]]
 +
* [[RXN-16044]]
 +
* [[RXN-16082]]
 +
* [[RXN-16094]]
 +
* [[RXN-16103]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16152]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-1623]]
 +
* [[RXN-16395]]
 +
* [[RXN-16759]]
 +
* [[RXN-17688]]
 +
* [[RXN-3142]]
 +
* [[RXN-5181]]
 +
* [[RXN-7645]]
 +
* [[RXN-7697]]
 +
* [[RXN-7792]]
 +
* [[RXN-8032]]
 +
* [[RXN-9624]]
 +
* [[RXN-9627]]
 +
* [[RXN-9629]]
 +
* [[RXN-9632]]
 +
* [[RXN-9648]]
 +
* [[RXN-9650]]
 +
* [[RXN-9651]]
 +
* [[RXN-9652]]
 +
* [[RXN-9653]]
 +
* [[RXN-9654]]
 +
* [[RXN-9666]]
 +
* [[RXN-9670]]
 +
* [[RXN0-1147]]
 +
* [[RXN0-6948]]
 +
* [[RXN1G-368]]
 +
* [[RXN1G-445]]
 +
* [[RXN1G-460]]
 +
* [[RXN1G-499]]
 +
* [[RXN3DJ-118]]
 +
* [[RXN3O-328]]
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 +
* [[SERINE-O-ACETTRAN-RXN]]
 +
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-epoxy-2-methylpropane}}
+
{{#set: common-name=coenzyme a}}
{{#set: molecular-weight=72.107}}
+
{{#set: molecular-weight=763.502}}
{{#set: inchi-key=inchikey=gelkghvafrcjna-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rgjoekwqdubaiz-ibosznhhsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite CO-A

  • common-name:
    • coenzyme a
  • molecular-weight:
    • 763.502
  • inchi-key:
    • rgjoekwqdubaiz-ibosznhhsa-j
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccs)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality