Difference between revisions of "CPD-7670"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * molecular-weight: ** 255.227 * inchi-key: ** pueddpcucprqny-zyuzmqfosa-n * smi...")
(Created page with "Category:metabolite == Metabolite CPD-7670 == * common-name: ** dimethyl sulfide * molecular-weight: ** 62.129 * inchi-key: ** qmmfvypahwmcms-uhfffaoysa-n * smiles: ** csc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8259 ==
+
== Metabolite CPD-7670 ==
 
* common-name:
 
* common-name:
** β-d-ribosylnicotinate
+
** dimethyl sulfide
 
* molecular-weight:
 
* molecular-weight:
** 255.227
+
** 62.129
 
* inchi-key:
 
* inchi-key:
** pueddpcucprqny-zyuzmqfosa-n
+
** qmmfvypahwmcms-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
+
** csc
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[2.1.1.19-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14227]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-ribosylnicotinate}}
+
{{#set: common-name=dimethyl sulfide}}
{{#set: molecular-weight=255.227}}
+
{{#set: molecular-weight=62.129}}
{{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}}
+
{{#set: inchi-key=inchikey=qmmfvypahwmcms-uhfffaoysa-n}}

Latest revision as of 19:32, 17 March 2021

Metabolite CPD-7670

  • common-name:
    • dimethyl sulfide
  • molecular-weight:
    • 62.129
  • inchi-key:
    • qmmfvypahwmcms-uhfffaoysa-n
  • smiles:
    • csc

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality