Difference between revisions of "RXN-7607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXYMETHYLBILANE == * common-name: ** preuroporphyrinogen * inchi-key: ** wdfjyrzcziubpr-uhfffaoysa-f * molecular-weight: ** 846.757 *...")
(Created page with "Category:metabolite == Metabolite CPD-20766 == * common-name: ** (2s)-3-(1h-indol-3-yl)-2-isocyanopropanoate * inchi-key: ** ubszgfbfcqbscz-nshdsacasa-m * molecular-weight...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDROXYMETHYLBILANE ==
+
== Metabolite CPD-20766 ==
 
* common-name:
 
* common-name:
** preuroporphyrinogen
+
** (2s)-3-(1h-indol-3-yl)-2-isocyanopropanoate
 
* inchi-key:
 
* inchi-key:
** wdfjyrzcziubpr-uhfffaoysa-f
+
** ubszgfbfcqbscz-nshdsacasa-m
 
* molecular-weight:
 
* molecular-weight:
** 846.757
+
** 213.215
 
* smiles:
 
* smiles:
** c(o)c4(/nc(\cc3(/nc(\cc2(/nc(\cc1(/nc=c(ccc(=o)[o-])c(\cc([o-])=o)=1))=c(ccc(=o)[o-])/c(\cc([o-])=o)=2))=c(ccc(=o)[o-])/c(\cc(=o)[o-])=3))=c(ccc(=o)[o-])/c(\cc(=o)[o-])=4)
+
** [c-]#[n+][c@@h](cc1(/c2(\c=cc=cc(/nc=1)=2)))c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14396]]
 
* [[UROGENIIISYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHMETHYLBILANESYN-RXN]]
+
* [[RXN-19264]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preuroporphyrinogen}}
+
{{#set: common-name=(2s)-3-(1h-indol-3-yl)-2-isocyanopropanoate}}
{{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}}
+
{{#set: inchi-key=inchikey=ubszgfbfcqbscz-nshdsacasa-m}}
{{#set: molecular-weight=846.757}}
+
{{#set: molecular-weight=213.215}}

Revision as of 09:54, 27 August 2020

Metabolite CPD-20766

  • common-name:
    • (2s)-3-(1h-indol-3-yl)-2-isocyanopropanoate
  • inchi-key:
    • ubszgfbfcqbscz-nshdsacasa-m
  • molecular-weight:
    • 213.215
  • smiles:
    • [c-]#[n+][c@@h](cc1(/c2(\c=cc=cc(/nc=1)=2)))c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality