Difference between revisions of "RXN-11410"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytosine-32-In-tRNAs == * common-name: ** a cytosine32 in trna == Reaction(s) known to consume the compound == * TRNA-S-TRANSFERASE-RXN...") |
(Created page with "Category:metabolite == Metabolite 3-PHENYLPROPIONATE == * common-name: ** 3-phenylpropanoate * inchi-key: ** xmiigolphokfch-uhfffaoysa-m * molecular-weight: ** 149.169 * s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-PHENYLPROPIONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phenylpropanoate |
+ | * inchi-key: | ||
+ | ** xmiigolphokfch-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 149.169 | ||
+ | * smiles: | ||
+ | ** c(ccc1(/c=cc=cc=1))([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-18229]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phenylpropanoate}} |
+ | {{#set: inchi-key=inchikey=xmiigolphokfch-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=149.169}} |
Revision as of 09:57, 27 August 2020
Contents
Metabolite 3-PHENYLPROPIONATE
- common-name:
- 3-phenylpropanoate
- inchi-key:
- xmiigolphokfch-uhfffaoysa-m
- molecular-weight:
- 149.169
- smiles:
- c(ccc1(/c=cc=cc=1))([o-])=o