Difference between revisions of "RXN-17729"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-Cysteine-Desulfurase-persulfide == * common-name: ** an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * inchi-key: ** ghrwxpxobgrshg-uhfffaoysa-n * molecular-weight: ** 631.069 * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9612 == |
* common-name: | * common-name: | ||
| − | ** | + | ** caldariellaquinone |
| + | * inchi-key: | ||
| + | ** ghrwxpxobgrshg-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 631.069 | ||
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(=o)c2(\sc=cc(\c(=o)c(\sc)=1)=2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15378]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=caldariellaquinone}} |
| + | {{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=631.069}} | ||
Revision as of 09:57, 27 August 2020
Contents
Metabolite CPD-9612
- common-name:
- caldariellaquinone
- inchi-key:
- ghrwxpxobgrshg-uhfffaoysa-n
- molecular-weight:
- 631.069
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(=o)c2(\sc=cc(\c(=o)c(\sc)=1)=2))
