Difference between revisions of "GARTRANSFORMYL2-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20746 == * common-name: ** nα,nε-diacetyl-lysyl-d-alanine * inchi-key: ** grepiccjtjbjko-uhfffaoysa-m * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * common-name: ** n-(5-phosphoribosyl)-anthranilate * inchi-key: ** pmfmjxprnjuymb-gwofurmssa-k * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20746 ==
+
== Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE ==
 
* common-name:
 
* common-name:
** nα,nε-diacetyl-lysyl-d-alanine
+
** n-(5-phosphoribosyl)-anthranilate
 
* inchi-key:
 
* inchi-key:
** grepiccjtjbjko-uhfffaoysa-m
+
** pmfmjxprnjuymb-gwofurmssa-k
 
* molecular-weight:
 
* molecular-weight:
** 300.334
+
** 346.21
 
* smiles:
 
* smiles:
** cc(c([o-])=o)nc(=o)c(nc(=o)c)ccccnc(c)=o
+
** c(op(=o)([o-])[o-])[c@@h]2(o[c@@h](nc1(\c=cc=cc(/c(=o)[o-])=1))[c@h](o)[c@h](o)2)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19249]]
+
* [[PRAISOM-RXN]]
 +
* [[PRTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-19249]]
+
* [[PRTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nα,nε-diacetyl-lysyl-d-alanine}}
+
{{#set: common-name=n-(5-phosphoribosyl)-anthranilate}}
{{#set: inchi-key=inchikey=grepiccjtjbjko-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}}
{{#set: molecular-weight=300.334}}
+
{{#set: molecular-weight=346.21}}

Revision as of 09:58, 27 August 2020

Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE

  • common-name:
    • n-(5-phosphoribosyl)-anthranilate
  • inchi-key:
    • pmfmjxprnjuymb-gwofurmssa-k
  • molecular-weight:
    • 346.21
  • smiles:
    • c(op(=o)([o-])[o-])[c@@h]2(o[c@@h](nc1(\c=cc=cc(/c(=o)[o-])=1))[c@h](o)[c@h](o)2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality