Difference between revisions of "1.2.1.13-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * inchi-key: ** ufzdimbxtvrbds-ssqlmynasa-n * molecular-weight: ** 636.999 * smiles:...")
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-FA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12117 ==
+
== Metabolite 2-Me-Branched-234-Sat-FA ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-7
+
** a 2-methyl branched 2,3,4-saturated fatty acid
* inchi-key:
 
** ufzdimbxtvrbds-ssqlmynasa-n
 
* molecular-weight:
 
** 636.999
 
* smiles:
 
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c=c(o)c2(\c=cc=cc(/c(\o)=1)=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9191]]
+
* [[RXN66-483]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9190]]
+
* [[RXN66-472]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-7}}
+
{{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acid}}
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
 
{{#set: molecular-weight=636.999}}
 

Revision as of 09:59, 27 August 2020

Metabolite 2-Me-Branched-234-Sat-FA

  • common-name:
    • a 2-methyl branched 2,3,4-saturated fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality