Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * inchi-key: ** vunqjppptjiren-cmaxttdksa-n * molecular-weight: ** 639.058 * s...")
(Created page with "Category:metabolite == Metabolite Short-glucans == * common-name: ** a short glucan == Reaction(s) known to consume the compound == == Reaction(s) known to produce the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 2-OCTAPRENYLPHENOL ==
+
== Metabolite Short-glucans ==
 
* common-name:
 
* common-name:
−
** 2-octaprenylphenol
+
** a short glucan
−
* inchi-key:
 
−
** vunqjppptjiren-cmaxttdksa-n
 
−
* molecular-weight:
 
−
** 639.058
 
−
* smiles:
 
−
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(\o)=c/c=cc=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3-OCTAPRENYL-4-OHBENZOATE-DECARBOX-RXN]]
+
* [[3.2.1.73-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2-octaprenylphenol}}
+
{{#set: common-name=a short glucan}}
−
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
 
−
{{#set: molecular-weight=639.058}}
 

Revision as of 07:09, 24 September 2020

Metabolite Short-glucans

  • common-name:
    • a short glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=ORNITHINE-CYCLODEAMINASE-RXN&oldid=32377"