Difference between revisions of "TRANS-RXN0-0244"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * molecular-weight: ** 666.583 * smiles: **...") |
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylsulfanyl)pentyl]malate * inchi-key: ** ybisuhxejdgadq-uhfffaoysa-l * molecular-weight: ** 248....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-38 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(5'-methylsulfanyl)pentyl]malate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ybisuhxejdgadq-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 248.293 |
* smiles: | * smiles: | ||
| − | ** | + | ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-18204]] | |
| − | + | * [[RXNQT-4171]] | |
| − | * [[RXN- | ||
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-18204]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-[(5'-methylsulfanyl)pentyl]malate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ybisuhxejdgadq-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=248.293}} |
Revision as of 07:09, 24 September 2020
Contents
Metabolite CPDQT-38
- common-name:
- 3-[(5'-methylsulfanyl)pentyl]malate
- inchi-key:
- ybisuhxejdgadq-uhfffaoysa-l
- molecular-weight:
- 248.293
- smiles:
- cscccccc(c(o)c(=o)[o-])c(=o)[o-]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(5'-methylsulfanyl)pentyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
