Difference between revisions of "RXN-16788"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * molecular-weight: ** 136.13 * smiles: ** c(c...")
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * inchi-key: ** gubgytabksrvrq-qrzgkkjrsa-n * molecular-weight: ** 342.299 * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ANTHRANILATE ==
+
== Metabolite CELLOBIOSE ==
 
* common-name:
 
* common-name:
** anthranilate
+
** β-d-cellobiose
 
* inchi-key:
 
* inchi-key:
** rwzyaggxghygmb-uhfffaoysa-m
+
** gubgytabksrvrq-qrzgkkjrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 136.13
+
** 342.299
 
* smiles:
 
* smiles:
** c(c1(/c(\n)=c/c=cc=1))(=o)[o-]
+
** c([c@h]2([c@h]([c@@h]([c@h]([c@h](o[c@h]1([c@h](o[c@h]([c@@h]([c@h]1o)o)o)co))o2)o)o)o))o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[ExchangeSeed-CELLOBIOSE]]
* [[PRTRANS-RXN]]
+
* [[Export_CELLOBIOSE]]
 +
* [[RXN-10773]]
 +
* [[TransportSeed-CELLOBIOSE]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[3.2.1.91-RXN]]
* [[PRTRANS-RXN]]
+
* [[ExchangeSeed-CELLOBIOSE]]
 +
* [[Export_CELLOBIOSE]]
 +
* [[TransportSeed-CELLOBIOSE]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anthranilate}}
+
{{#set: common-name=β-d-cellobiose}}
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}}
{{#set: molecular-weight=136.13}}
+
{{#set: molecular-weight=342.299}}

Revision as of 07:10, 24 September 2020

Metabolite CELLOBIOSE

  • common-name:
    • β-d-cellobiose
  • inchi-key:
    • gubgytabksrvrq-qrzgkkjrsa-n
  • molecular-weight:
    • 342.299
  • smiles:
    • c([c@h]2([c@h]([c@@h]([c@h]([c@h](o[c@h]1([c@h](o[c@h]([c@@h]([c@h]1o)o)o)co))o2)o)o)o))o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality