Difference between revisions of "GLUTKIN-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * common-name: ** 8-amino-7-oxononanoate * inchi-key: ** guahpajoxvyfon-uhfffaoysa-n * molecular-weight: ** 187...")
(Created page with "Category:metabolite == Metabolite CPD-10484 == * common-name: ** dehypoxanthine futalosine * inchi-key: ** xwpbbhhzdysyms-hkumriaesa-m * molecular-weight: ** 295.268 * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 8-AMINO-7-OXONONANOATE ==
+
== Metabolite CPD-10484 ==
 
* common-name:
 
* common-name:
** 8-amino-7-oxononanoate
+
** dehypoxanthine futalosine
 
* inchi-key:
 
* inchi-key:
** guahpajoxvyfon-uhfffaoysa-n
+
** xwpbbhhzdysyms-hkumriaesa-m
 
* molecular-weight:
 
* molecular-weight:
** 187.238
+
** 295.268
 
* smiles:
 
* smiles:
** cc(c(cccccc([o-])=o)=o)[n+]
+
** c([o-])(=o)c1(/c=cc=c(c=1)c(=o)cc[c@h]2([c@@h](o)[c@@h](o)[c@h](o)o2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAPASYN-RXN]]
+
* [[RXN-10620]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[7KAPSYN-RXN]]
+
* [[RXN-12346]]
* [[DAPASYN-RXN]]
+
* [[RXN-9780]]
* [[RXN-11484]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-amino-7-oxononanoate}}
+
{{#set: common-name=dehypoxanthine futalosine}}
{{#set: inchi-key=inchikey=guahpajoxvyfon-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=xwpbbhhzdysyms-hkumriaesa-m}}
{{#set: molecular-weight=187.238}}
+
{{#set: molecular-weight=295.268}}

Revision as of 06:57, 9 October 2020

Metabolite CPD-10484

  • common-name:
    • dehypoxanthine futalosine
  • inchi-key:
    • xwpbbhhzdysyms-hkumriaesa-m
  • molecular-weight:
    • 295.268
  • smiles:
    • c([o-])(=o)c1(/c=cc=c(c=1)c(=o)cc[c@h]2([c@@h](o)[c@@h](o)[c@h](o)o2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality