Difference between revisions of "RXN-19728"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * inchi-key: ** yxjdfqjkerbobm-txicztdvsa-l * molecular-weight: ** 228.095 *...")
(Created page with "Category:metabolite == Metabolite UBIQUINONE-6 == * common-name: ** ubiquinone-6 * inchi-key: ** gxnfpeoukfotky-lphqiwjtsa-n * molecular-weight: ** 590.885 * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOSE-1P ==
+
== Metabolite UBIQUINONE-6 ==
 
* common-name:
 
* common-name:
** α-d-ribose-1-phosphate
+
** ubiquinone-6
 
* inchi-key:
 
* inchi-key:
** yxjdfqjkerbobm-txicztdvsa-l
+
** gxnfpeoukfotky-lphqiwjtsa-n
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 590.885
 
* smiles:
 
* smiles:
** c(o)[c@h]1([c@@h](o)[c@@h](o)[c@@h](op(=o)([o-])[o-])o1)
+
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPHOSPHOR-RXN]]
+
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]]
* [[INOPHOSPHOR-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN0-5199]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENPHOSPHOR-RXN]]
 
* [[INOPHOSPHOR-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN0-5199]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose-1-phosphate}}
+
{{#set: common-name=ubiquinone-6}}
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
+
{{#set: inchi-key=inchikey=gxnfpeoukfotky-lphqiwjtsa-n}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=590.885}}

Revision as of 06:57, 9 October 2020

Metabolite UBIQUINONE-6

  • common-name:
    • ubiquinone-6
  • inchi-key:
    • gxnfpeoukfotky-lphqiwjtsa-n
  • molecular-weight:
    • 590.885
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality