Difference between revisions of "RXN-19728"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * inchi-key: ** yxjdfqjkerbobm-txicztdvsa-l * molecular-weight: ** 228.095 *...") |
(Created page with "Category:metabolite == Metabolite UBIQUINONE-6 == * common-name: ** ubiquinone-6 * inchi-key: ** gxnfpeoukfotky-lphqiwjtsa-n * molecular-weight: ** 590.885 * smiles: ** cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UBIQUINONE-6 == |
* common-name: | * common-name: | ||
− | ** | + | ** ubiquinone-6 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gxnfpeoukfotky-lphqiwjtsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 590.885 |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ubiquinone-6}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gxnfpeoukfotky-lphqiwjtsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=590.885}} |
Revision as of 06:57, 9 October 2020
Contents
Metabolite UBIQUINONE-6
- common-name:
- ubiquinone-6
- inchi-key:
- gxnfpeoukfotky-lphqiwjtsa-n
- molecular-weight:
- 590.885
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o)