Difference between revisions of "RXN-7607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * inchi-key: ** ufphfkctoziafy-ntdveaecsa-l * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * inchi-key: ** jvefyxpcqbmmaa-zmlwrgbosa-j * molecular-weight: ** 969.83 * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9646 ==
+
== Metabolite CPD0-1162 ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl phosphate
+
** (2e,5z)-tetradecenoyl-coa
 
* inchi-key:
 
* inchi-key:
** ufphfkctoziafy-ntdveaecsa-l
+
** jvefyxpcqbmmaa-zmlwrgbosa-j
 
* molecular-weight:
 
* molecular-weight:
** 845.279
+
** 969.83
 
* smiles:
 
* smiles:
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop(=o)([o-])[o-]
+
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)[c@h](o)c(c)(c)cop(=o)(op(=o)(oc[c@h]1([c@@h](op([o-])(=o)[o-])[c@@h](o)[c@@h](o1)n2(c3(n=cn=c(c(n=c2)=3)n))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.8.6-RXN]]
 
* [[PHOSNACMURPENTATRANS-RXN]]
 
* [[RXN-11347]]
 
* [[RXN-8975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.8.6-RXN]]
+
* [[RXN-17783]]
* [[RXN-8975]]
 
* [[UNDECAPRENYL-DIPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
+
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
+
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
{{#set: molecular-weight=845.279}}
+
{{#set: molecular-weight=969.83}}

Revision as of 06:58, 9 October 2020

Metabolite CPD0-1162

  • common-name:
    • (2e,5z)-tetradecenoyl-coa
  • inchi-key:
    • jvefyxpcqbmmaa-zmlwrgbosa-j
  • molecular-weight:
    • 969.83
  • smiles:
    • ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)[c@h](o)c(c)(c)cop(=o)(op(=o)(oc[c@h]1([c@@h](op([o-])(=o)[o-])[c@@h](o)[c@@h](o1)n2(c3(n=cn=c(c(n=c2)=3)n))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality