Difference between revisions of "GARTRANSFORMYL2-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-stearoyl-ACPs == * common-name: ** a 3-oxooctadecanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9633 == Reac...") |
(Created page with "Category:metabolite == Metabolite UBIQUINOL-30 == * common-name: ** ubiquinol-6 * inchi-key: ** dyoscpiqeyrqeo-lphqiwjtsa-n * molecular-weight: ** 592.901 * smiles: ** cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UBIQUINOL-30 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinol-6 |
| + | * inchi-key: | ||
| + | ** dyoscpiqeyrqeo-lphqiwjtsa-n | ||
| + | * molecular-weight: | ||
| + | ** 592.901 | ||
| + | * smiles: | ||
| + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c(/oc)=c(c(\c)=1)/o)/oc) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinol-6}} |
| + | {{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}} | ||
| + | {{#set: molecular-weight=592.901}} | ||
Revision as of 07:02, 9 October 2020
Contents
Metabolite UBIQUINOL-30
- common-name:
- ubiquinol-6
- inchi-key:
- dyoscpiqeyrqeo-lphqiwjtsa-n
- molecular-weight:
- 592.901
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c(/oc)=c(c(\c)=1)/o)/oc)
