Difference between revisions of "DEHYDROQUINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IS30-with-Integrated-Transposon == * common-name: ** an insertion sequence is30 with integrated transposon == Reaction(s) known to consum...") |
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-weight: ** 155.09 * smiles: ** c1(/c(=o)nc(n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OROTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** orotate |
| + | * inchi-key: | ||
| + | ** pxqpewdeaktcgb-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 155.09 | ||
| + | * smiles: | ||
| + | ** c1(/c(=o)nc(nc(\c([o-])=o)=1)=o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OROPRIBTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN0- | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| + | * [[OROPRIBTRANS-RXN]] | ||
| + | * [[RXN-9929]] | ||
| + | * [[RXN0-6491]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=orotate}} |
| + | {{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=155.09}} | ||
Revision as of 17:42, 3 November 2020
Contents
Metabolite OROTATE
- common-name:
- orotate
- inchi-key:
- pxqpewdeaktcgb-uhfffaoysa-m
- molecular-weight:
- 155.09
- smiles:
- c1(/c(=o)nc(nc(\c([o-])=o)=1)=o)
