Difference between revisions of "TRANS-RXN0-0244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12258 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine * inchi-key: ** foedsvrzgqix...")
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylsulfanyl)heptyl]malate * inchi-key: ** sxljfgxgvbwoob-uhfffaoysa-l * molecular-weight: ** 276....")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12258 ==
+
== Metabolite CPDQT-40 ==
 
* common-name:
 
* common-name:
−
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine
+
** 3-[(7'-methylsulfanyl)heptyl]malate
 
* inchi-key:
 
* inchi-key:
−
** foedsvrzgqixsp-xsoiktqosa-k
+
** sxljfgxgvbwoob-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 1075.843
+
** 276.347
 
* smiles:
 
* smiles:
−
** c[c@@h](c(=o)n[c@@h](c(=o)[o-])ccc(=o)n[c@@h](cccc[n+])c(n[c@h](c)c(=o)[o-])=o)nc(=o)[c@@h](c)o[c@@h]1([c@h](o)[c@@h](co)o[c@@h]([c@h](nc(=o)c)1)op(op(oc[c@@h]2(o[c@h]([c@h](o)[c@h](o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
+
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11347]]
+
* [[RXN-18200]]
 +
* [[RXNQT-4178]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18200]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine}}
+
{{#set: common-name=3-[(7'-methylsulfanyl)heptyl]malate}}
−
{{#set: inchi-key=inchikey=foedsvrzgqixsp-xsoiktqosa-k}}
+
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
−
{{#set: molecular-weight=1075.843}}
+
{{#set: molecular-weight=276.347}}

Revision as of 17:45, 3 November 2020

Metabolite CPDQT-40

  • common-name:
    • 3-[(7'-methylsulfanyl)heptyl]malate
  • inchi-key:
    • sxljfgxgvbwoob-uhfffaoysa-l
  • molecular-weight:
    • 276.347
  • smiles:
    • cscccccccc(c(o)c(=o)[o-])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-[(7'-methylsulfanyl)heptyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=TRANS-RXN0-0244&oldid=48796"