Difference between revisions of "GARTRANSFORMYL2-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINOL-30 == * common-name: ** ubiquinol-6 * inchi-key: ** dyoscpiqeyrqeo-lphqiwjtsa-n * molecular-weight: ** 592.901 * smiles: ** cc(...") |
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * inchi-key: ** s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite C4 == |
* common-name: | * common-name: | ||
− | ** | + | ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sulooaflxmqjsf-ogdyfqgpsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1670.034 |
* smiles: | * smiles: | ||
− | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ | + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop(op(=o)([o-])o[c@h]1([c@h](nc(c)=o)[c@@h](o[c@h](c)c(=o)n[c@@h](c)c(=o)n[c@@h](c(=o)[o-])ccc(=o)n[c@@h](cccc[n+])c(n[c@h](c)c(=o)n[c@h](c)c([o-])=o)=o)[c@h](o)[c@@h](co)o1))([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8975]] | ||
+ | * [[RXN-8976]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8975]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1670.034}} |
Revision as of 17:46, 3 November 2020
Contents
Metabolite C4
- common-name:
- undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
- inchi-key:
- sulooaflxmqjsf-ogdyfqgpsa-k
- molecular-weight:
- 1670.034
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop(op(=o)([o-])o[c@h]1([c@h](nc(c)=o)[c@@h](o[c@h](c)c(=o)n[c@@h](c)c(=o)n[c@@h](c(=o)[o-])ccc(=o)n[c@@h](cccc[n+])c(n[c@h](c)c(=o)n[c@h](c)c([o-])=o)=o)[c@h](o)[c@@h](co)o1))([o-])=o