Difference between revisions of "CARBOXYCYCLOHEXADIENYL-DEHYDRATASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * inchi-key: ** ghrwxpxobgrshg-uhfffaoysa-n * molecular-weight: ** 631.069 * smiles: **...")
(Created page with "Category:metabolite == Metabolite Menaquinones == * common-name: ** a menaquinone == Reaction(s) known to consume the compound == * R601-RXN * RXN0-6259 == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9612 ==
+
== Metabolite Menaquinones ==
 
* common-name:
 
* common-name:
** caldariellaquinone
+
** a menaquinone
* inchi-key:
 
** ghrwxpxobgrshg-uhfffaoysa-n
 
* molecular-weight:
 
** 631.069
 
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(=o)c2(\sc=cc(\c(=o)c(\sc)=1)=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15378]]
+
* [[R601-RXN]]
 +
* [[RXN0-6259]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[R601-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinone}}
+
{{#set: common-name=a menaquinone}}
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
 
{{#set: molecular-weight=631.069}}
 

Revision as of 17:46, 3 November 2020

Metabolite Menaquinones

  • common-name:
    • a menaquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality