Difference between revisions of "PYRAMKIN-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UREA == * common-name: ** urea * inchi-key: ** xsqukjjjfzcrtk-uhfffaoysa-n * molecular-weight: ** 60.055 * smiles: ** c(=o)(n)n == Reacti...")
(Created page with "Category:metabolite == Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-octaprenyl-4-hydroxybenzoate * inchi-key: ** utibhebnildqkx-lqokpsqisa-m * molecula...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UREA ==
+
== Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE ==
 
* common-name:
 
* common-name:
** urea
+
** 3-octaprenyl-4-hydroxybenzoate
 
* inchi-key:
 
* inchi-key:
** xsqukjjjfzcrtk-uhfffaoysa-n
+
** utibhebnildqkx-lqokpsqisa-m
 
* molecular-weight:
 
* molecular-weight:
** 60.055
+
** 682.06
 
* smiles:
 
* smiles:
** c(=o)(n)n
+
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c=c(c(=o)[o-])c=cc(\o)=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARGINASE-RXN]]
+
* [[3-OCTAPRENYL-4-OHBENZOATE-DECARBOX-RXN]]
* [[UREASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AGMATIN-RXN]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
* [[ARGINASE-RXN]]
 
* [[UREASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=urea}}
+
{{#set: common-name=3-octaprenyl-4-hydroxybenzoate}}
{{#set: inchi-key=inchikey=xsqukjjjfzcrtk-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=utibhebnildqkx-lqokpsqisa-m}}
{{#set: molecular-weight=60.055}}
+
{{#set: molecular-weight=682.06}}

Revision as of 17:47, 3 November 2020

Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-octaprenyl-4-hydroxybenzoate
  • inchi-key:
    • utibhebnildqkx-lqokpsqisa-m
  • molecular-weight:
    • 682.06
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c=c(c(=o)[o-])c=cc(\o)=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality