Difference between revisions of "DEHYDROQUINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-weight: ** 155.09 * smiles: ** c1(/c(=o)nc(n...") |
(Created page with "Category:metabolite == Metabolite CPD-11984 == * common-name: ** mono-trans,octa-cis-decaprenyl diphosphate * inchi-key: ** fscyhdcthrvskn-djngbrkisa-k * molecular-weight:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11984 == |
* common-name: | * common-name: | ||
− | ** | + | ** mono-trans,octa-cis-decaprenyl diphosphate |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fscyhdcthrvskn-djngbrkisa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 856.133 |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop([o-])(=o)op([o-])(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11301]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=mono-trans,octa-cis-decaprenyl diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fscyhdcthrvskn-djngbrkisa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=856.133}} |
Revision as of 18:58, 13 January 2021
Contents
Metabolite CPD-11984
- common-name:
- mono-trans,octa-cis-decaprenyl diphosphate
- inchi-key:
- fscyhdcthrvskn-djngbrkisa-k
- molecular-weight:
- 856.133
- smiles:
- cc(c)=cccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop([o-])(=o)op([o-])(=o)[o-]