Difference between revisions of "DEHYDROQUINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-weight: ** 155.09 * smiles: ** c1(/c(=o)nc(n...")
(Created page with "Category:metabolite == Metabolite CPD-11984 == * common-name: ** mono-trans,octa-cis-decaprenyl diphosphate * inchi-key: ** fscyhdcthrvskn-djngbrkisa-k * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OROTATE ==
+
== Metabolite CPD-11984 ==
 
* common-name:
 
* common-name:
** orotate
+
** mono-trans,octa-cis-decaprenyl diphosphate
 
* inchi-key:
 
* inchi-key:
** pxqpewdeaktcgb-uhfffaoysa-m
+
** fscyhdcthrvskn-djngbrkisa-k
 
* molecular-weight:
 
* molecular-weight:
** 155.09
+
** 856.133
 
* smiles:
 
* smiles:
** c1(/c(=o)nc(nc(\c([o-])=o)=1)=o)
+
** cc(c)=cccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop([o-])(=o)op([o-])(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OROPRIBTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
* [[RXN-11301]]
* [[OROPRIBTRANS-RXN]]
 
* [[RXN-9929]]
 
* [[RXN0-6491]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=orotate}}
+
{{#set: common-name=mono-trans,octa-cis-decaprenyl diphosphate}}
{{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=fscyhdcthrvskn-djngbrkisa-k}}
{{#set: molecular-weight=155.09}}
+
{{#set: molecular-weight=856.133}}

Revision as of 18:58, 13 January 2021

Metabolite CPD-11984

  • common-name:
    • mono-trans,octa-cis-decaprenyl diphosphate
  • inchi-key:
    • fscyhdcthrvskn-djngbrkisa-k
  • molecular-weight:
    • 856.133
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop([o-])(=o)op([o-])(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality