Difference between revisions of "TRANS-RXN0-0244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylsulfanyl)heptyl]malate * inchi-key: ** sxljfgxgvbwoob-uhfffaoysa-l * molecular-weight: ** 276....")
(Created page with "Category:metabolite == Metabolite Malonyl-BryU-ACP == * common-name: ** a malonyl-[bryu acyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-40 ==
+
== Metabolite Malonyl-BryU-ACP ==
 
* common-name:
 
* common-name:
** 3-[(7'-methylsulfanyl)heptyl]malate
+
** a malonyl-[bryu acyl-carrier protein]
* inchi-key:
 
** sxljfgxgvbwoob-uhfffaoysa-l
 
* molecular-weight:
 
** 276.347
 
* smiles:
 
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18200]]
 
* [[RXNQT-4178]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18200]]
+
* [[RXN-20481]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(7'-methylsulfanyl)heptyl]malate}}
+
{{#set: common-name=a malonyl-[bryu acyl-carrier protein]}}
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
 
{{#set: molecular-weight=276.347}}
 

Revision as of 19:01, 13 January 2021

Metabolite Malonyl-BryU-ACP

  • common-name:
    • a malonyl-[bryu acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a malonyl-[bryu acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.