Difference between revisions of "ExchangeSeed-NADH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNAs-containing-epoxy-quenosine == * common-name: ** an epoxyqueuosine34 in trna == Reaction(s) known to consume the compound == * RXN...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * inchi-key: ** hdsgdgslnm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNAs-containing-epoxy-quenosine ==
+
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
 
* common-name:
 
* common-name:
** an epoxyqueuosine34 in trna
+
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
 +
* inchi-key:
 +
** hdsgdgslnmimku-kfsstaeesa-n
 +
* molecular-weight:
 +
** 699.111
 +
* smiles:
 +
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c=c(c(\o)=1)oc)/o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12104]]
+
* [[OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1342]]
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an epoxyqueuosine34 in trna}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
 +
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
 +
{{#set: molecular-weight=699.111}}

Revision as of 19:33, 13 January 2021

Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
  • inchi-key:
    • hdsgdgslnmimku-kfsstaeesa-n
  • molecular-weight:
    • 699.111
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c=c(c(\o)=1)oc)/o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality