Difference between revisions of "PYRAMKIN-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-BETA-ASPARTYL-P == * common-name: ** l-aspartyl-4-phosphate * inchi-key: ** ixznktpiykdigg-reohclbhsa-l * molecular-weight: ** 211.068...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * inchi-key: ** yhhsonzfoiemcp-uhfffaoysa-m * molecular-weight: ** 182.136 * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHOSPHORYL-CHOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** phosphocholine |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yhhsonzfoiemcp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.136 |
* smiles: | * smiles: | ||
| − | ** c | + | ** c[n+](ccop([o-])([o-])=o)(c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.15-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phosphocholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.136}} |
Revision as of 19:33, 13 January 2021
Contents
Metabolite PHOSPHORYL-CHOLINE
- common-name:
- phosphocholine
- inchi-key:
- yhhsonzfoiemcp-uhfffaoysa-m
- molecular-weight:
- 182.136
- smiles:
- c[n+](ccop([o-])([o-])=o)(c)c
