Difference between revisions of "RXN-16788"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20746 == * common-name: ** nα,nε-diacetyl-lysyl-d-alanine * inchi-key: ** grepiccjtjbjko-uhfffaoysa-m * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite EG10823-MONOMER == == Reaction(s) known to consume the compound == * RXN-19004 == Reaction(s) known to produce the compound == == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20746 ==
+
== Metabolite EG10823-MONOMER ==
* common-name:
 
** nα,nε-diacetyl-lysyl-d-alanine
 
* inchi-key:
 
** grepiccjtjbjko-uhfffaoysa-m
 
* molecular-weight:
 
** 300.334
 
* smiles:
 
** cc(c([o-])=o)nc(=o)c(nc(=o)c)ccccnc(c)=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19249]]
+
* [[RXN-19004]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-19249]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nα,nε-diacetyl-lysyl-d-alanine}}
 
{{#set: inchi-key=inchikey=grepiccjtjbjko-uhfffaoysa-m}}
 
{{#set: molecular-weight=300.334}}
 

Revision as of 11:56, 15 January 2021

Metabolite EG10823-MONOMER

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality