Difference between revisions of "1-4-Mannan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * molecular-weight: ** 130.057 * smiles: **...")
(Created page with "Category:metabolite == Metabolite THYMINE == * common-name: ** thymine * inchi-key: ** rwqnbrdokxibiv-uhfffaoysa-n * molecular-weight: ** 126.115 * smiles: ** cc1(/c(=o)nc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXALACETIC_ACID ==
+
== Metabolite THYMINE ==
 
* common-name:
 
* common-name:
** oxaloacetate
+
** thymine
 
* inchi-key:
 
* inchi-key:
** khpxuqmniqbqev-uhfffaoysa-l
+
** rwqnbrdokxibiv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 130.057
+
** 126.115
 
* smiles:
 
* smiles:
** c(c([o-])=o)c(=o)c([o-])=o
+
** cc1(/c(=o)nc(nc=1)=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.4.1.21-RXN]]
+
* [[THYM-PHOSPH-RXN]]
* [[2.6.1.70-RXN]]
 
* [[4.1.1.32-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[CITSYN-RXN]]
 
* [[D--TARTRATE-DEHYDRATASE-RXN]]
 
* [[MALATE-DEH-RXN]]
 
* [[OXALODECARB-RXN]]
 
* [[PEPCARBOXYKIN-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[PYROXALTRANSAM-RXN]]
 
* [[RXN-12481]]
 
* [[RXN-13697]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.4.1.21-RXN]]
+
* [[THYM-PHOSPH-RXN]]
* [[2.6.1.70-RXN]]
 
* [[4.1.1.32-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[D--TARTRATE-DEHYDRATASE-RXN]]
 
* [[LTARTDEHYDRA-RXN]]
 
* [[MALATE-DEH-RXN]]
 
* [[MALATE-DEHYDROGENASE-ACCEPTOR-RXN]]
 
* [[PEPCARBOX-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[PYROXALTRANSAM-RXN]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[RXN-12481]]
 
* [[RXN-13697]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxaloacetate}}
+
{{#set: common-name=thymine}}
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=rwqnbrdokxibiv-uhfffaoysa-n}}
{{#set: molecular-weight=130.057}}
+
{{#set: molecular-weight=126.115}}

Revision as of 15:53, 18 March 2021

Metabolite THYMINE

  • common-name:
    • thymine
  • inchi-key:
    • rwqnbrdokxibiv-uhfffaoysa-n
  • molecular-weight:
    • 126.115
  • smiles:
    • cc1(/c(=o)nc(nc=1)=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality