Difference between revisions of "TRANS-RXN0-0244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylsulfanyl)heptyl]malate * inchi-key: ** sxljfgxgvbwoob-uhfffaoysa-l * molecular-weight: ** 276....")
(Created page with "Category:metabolite == Metabolite CPD-8490 == * common-name: ** decanal * inchi-key: ** ksmvzqyavgtkiv-uhfffaoysa-n * molecular-weight: ** 156.267 * smiles: ** ccccccccc[c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-40 ==
+
== Metabolite CPD-8490 ==
 
* common-name:
 
* common-name:
** 3-[(7'-methylsulfanyl)heptyl]malate
+
** decanal
 
* inchi-key:
 
* inchi-key:
** sxljfgxgvbwoob-uhfffaoysa-l
+
** ksmvzqyavgtkiv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 276.347
+
** 156.267
 
* smiles:
 
* smiles:
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** ccccccccc[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18200]]
+
* [[RXN-16653]]
* [[RXNQT-4178]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18200]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(7'-methylsulfanyl)heptyl]malate}}
+
{{#set: common-name=decanal}}
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=ksmvzqyavgtkiv-uhfffaoysa-n}}
{{#set: molecular-weight=276.347}}
+
{{#set: molecular-weight=156.267}}

Revision as of 15:55, 18 March 2021

Metabolite CPD-8490

  • common-name:
    • decanal
  • inchi-key:
    • ksmvzqyavgtkiv-uhfffaoysa-n
  • molecular-weight:
    • 156.267
  • smiles:
    • ccccccccc[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality