Difference between revisions of "PYRAMKIN-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * inchi-key: ** yhhsonzfoiemcp-uhfffaoysa-m * molecular-weight: ** 182.136 * smile...")
(Created page with "Category:metabolite == Metabolite Charged-THR-tRNAs == * common-name: ** an l-threonyl-[trnathr] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORYL-CHOLINE ==
+
== Metabolite Charged-THR-tRNAs ==
 
* common-name:
 
* common-name:
** phosphocholine
+
** an l-threonyl-[trnathr]
* inchi-key:
 
** yhhsonzfoiemcp-uhfffaoysa-m
 
* molecular-weight:
 
** 182.136
 
* smiles:
 
** c[n+](ccop([o-])([o-])=o)(c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.15-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphocholine}}
+
{{#set: common-name=an l-threonyl-[trnathr]}}
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
 
{{#set: molecular-weight=182.136}}
 

Revision as of 15:57, 18 March 2021

Metabolite Charged-THR-tRNAs

  • common-name:
    • an l-threonyl-[trnathr]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-threonyl-[trnathr" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.