Difference between revisions of "Repressor-LexA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FISUC_RS11285 == * common-name: ** aroe * transcription-direction: ** negative * centisome-position: ** 71.89777 * left-end-position: ** 2762769...")
(Created page with "Category:metabolite == Metabolite ADENINE == * common-name: ** adenine * inchi-key: ** gffgjbxgbjisgv-uhfffaoysa-n * molecular-weight: ** 135.128 * smiles: ** c2(n)(n=cn=c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FISUC_RS11285 ==
+
== Metabolite ADENINE ==
 
* common-name:
 
* common-name:
−
** aroe
+
** adenine
−
* transcription-direction:
+
* inchi-key:
−
** negative
+
** gffgjbxgbjisgv-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 71.89777   
+
** 135.128
−
* left-end-position:
+
* smiles:
−
** 2762769
+
** c2(n)(n=cn=c1(nc=nc/1=2))
−
* right-end-position:
+
== Reaction(s) known to consume the compound ==
−
** 2763686
+
* [[ADENPHOSPHOR-RXN]]
−
== Organism(s) associated with this gene  ==
+
* [[ADENPRIBOSYLTRAN-RXN]]
−
* [[fibrobacter_18032021]]
+
* [[DEOXYADENPHOSPHOR-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
* [[2.7.8.25-RXN]]
−
** Category: [[annotation]]
+
* [[ADENOSINE-NUCLEOSIDASE-RXN]]
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
−
== Pathway(s) associated ==
+
* [[ADENPHOSPHOR-RXN]]
−
* [[PWY-6163]]
+
* [[AMP-NUCLEOSID-RXN]]
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[DEOXYADENPHOSPHOR-RXN]]
−
{{#set: common-name=aroe}}
+
* [[RXN-12346]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN0-1342]]
−
{{#set: centisome-position=71.89777    }}
+
* [[RXN0-2661]]
−
{{#set: left-end-position=2762769}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: right-end-position=2763686}}
+
{{#set: common-name=adenine}}
−
{{#set: organism associated=fibrobacter_18032021}}
+
{{#set: inchi-key=inchikey=gffgjbxgbjisgv-uhfffaoysa-n}}
−
{{#set: nb reaction associated=1}}
+
{{#set: molecular-weight=135.128}}
−
{{#set: nb pathway associated=1}}
 

Revision as of 17:59, 26 April 2021

Metabolite ADENINE

  • common-name:
    • adenine
  • inchi-key:
    • gffgjbxgbjisgv-uhfffaoysa-n
  • molecular-weight:
    • 135.128
  • smiles:
    • c2(n)(n=cn=c1(nc=nc/1=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=Repressor-LexA&oldid=74218"