Difference between revisions of "Charged-fMET-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FISUC_RS04370 == * common-name: ** glms * transcription-direction: ** positive * centisome-position: ** 28.348518 * left-end-position: ** 1089330...")
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * inchi-key: ** lflucdosqpjjbe-uhfffaoysa-k * molecular-weight: ** 181.018...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FISUC_RS04370 ==
+
== Metabolite 3-P-HYDROXYPYRUVATE ==
 
* common-name:
 
* common-name:
−
** glms
+
** 3-phosphooxypyruvate
−
* transcription-direction:
+
* inchi-key:
−
** positive
+
** lflucdosqpjjbe-uhfffaoysa-k
−
* centisome-position:
+
* molecular-weight:
−
** 28.348518   
+
** 181.018
−
* left-end-position:
+
* smiles:
−
** 1089330
+
** c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
−
* right-end-position:
+
== Reaction(s) known to consume the compound ==
−
** 1091159
+
* [[PGLYCDEHYDROG-RXN]]
−
== Organism(s) associated with this gene  ==
+
* [[PSERTRANSAM-RXN]]
−
* [[fibrobacter_18032021]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[PGLYCDEHYDROG-RXN]]
−
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
* [[PSERTRANSAM-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-17808]]
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) associated ==
+
{{#set: common-name=3-phosphooxypyruvate}}
−
* [[PWY-8013]]
+
{{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}}
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
{{#set: molecular-weight=181.018}}
−
* [[PWY-6749]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[UDPNACETYLGALSYN-PWY]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
* [[UDPNAGSYN-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: common-name=glms}}
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: centisome-position=28.348518    }}
 
−
{{#set: left-end-position=1089330}}
 
−
{{#set: right-end-position=1091159}}
 
−
{{#set: organism associated=fibrobacter_18032021}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 17:59, 26 April 2021

Metabolite 3-P-HYDROXYPYRUVATE

  • common-name:
    • 3-phosphooxypyruvate
  • inchi-key:
    • lflucdosqpjjbe-uhfffaoysa-k
  • molecular-weight:
    • 181.018
  • smiles:
    • c(op([o-])(=o)[o-])c(=o)c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=Charged-fMET-tRNAs&oldid=74372"