Difference between revisions of "CPD0-2433"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene FISUC_RS06730 == * transcription-direction: ** positive * centisome-position: ** 43.59644 * left-end-position: ** 1675252 * right-end-position: *...") |
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * inchi-key: ** jazbehyotptenj-jlnkqsitsa-m * m...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == |
− | * | + | * common-name: |
− | ** | + | ** (5z,8z,11z,14z,17z)-icosapentaenoate |
− | * | + | * inchi-key: |
− | ** | + | ** jazbehyotptenj-jlnkqsitsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 301.448 |
− | * | + | * smiles: |
− | ** | + | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12978]] | |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}} | |
− | + | {{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}} | |
− | + | {{#set: molecular-weight=301.448}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 18:02, 26 April 2021
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- common-name:
- (5z,8z,11z,14z,17z)-icosapentaenoate
- inchi-key:
- jazbehyotptenj-jlnkqsitsa-m
- molecular-weight:
- 301.448
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]