Difference between revisions of "RXN-16788"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa-n * molecular-weight: ** 177.202 * smiles:...")
(Created page with "Category:reaction == Reaction 2.3.1.128-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/2.3.1.266 ec-2.3.1.266] * direction: ** left-to-right * common-name: ** ribosom...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite INDOLE-3-GLYCOL ==
+
== Reaction 2.3.1.128-RXN ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.266 ec-2.3.1.266]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
−
** indole-3-glycol
+
** ribosomal protein s18-alanine n-acetyltransferase
−
* inchi-key:
+
== Reaction formula ==
−
** xnjdzrgywqbbmz-uhfffaoysa-n
+
* 1 [[ACETYL-COA]][c] '''+''' 1 [[S18-N-terminal-L-alanine]][c] '''=>''' 1 [[Acetylated-S18-N-terminal-L-alanine]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c]
−
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
−
** 177.202
+
* Gene: [[FSU_RS02145]]
−
* smiles:
+
** Category: [[annotation]]
−
** c1(\nc2(\c=cc=cc(/c(\c(o)co)=1)=2))
+
*** Source: [[genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
== Reaction(s) known to consume the compound ==
+
* Gene: [[FISUC_RS00275]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[RXN-5424]]
+
*** Source: [[genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
== Reaction(s) of unknown directionality ==
+
== Pathway(s) ==
−
{{#set: common-name=indole-3-glycol}}
+
== Reconstruction information  ==
−
{{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}}
+
* category: [[annotation]]; source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=177.202}}
+
== External links  ==
 +
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16434 16434]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R04316 R04316]
 +
* UNIPROT:
 +
** [http://www.uniprot.org/uniprot/P0A944 P0A944]
 +
** [http://www.uniprot.org/uniprot/Q9ZCN0 Q9ZCN0]
 +
** [http://www.uniprot.org/uniprot/P0A948 P0A948]
 +
** [http://www.uniprot.org/uniprot/Q49857 Q49857]
 +
** [http://www.uniprot.org/uniprot/P73741 P73741]
 +
{{#set: ec-number=ec-2.3.1.266}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=ribosomal protein s18-alanine n-acetyltransferase}}
 +
{{#set: nb gene associated=2}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=genome}}

Revision as of 18:06, 26 April 2021

Reaction 2.3.1.128-RXN

  • ec-number:
  • direction:
    • left-to-right
  • common-name:
    • ribosomal protein s18-alanine n-acetyltransferase

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links





Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=RXN-16788&oldid=76643"