Difference between revisions of "DEHYDROSPHINGANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite a-mature-triacylated-lipoprotein == * common-name: ** an n-acyl-(s-diacyl-sn-glyceryl)-l-cysteinyl-[lipoprotein] == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * inchi-key: ** czfrmaseeptbaq-mycg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol |
| + | * inchi-key: | ||
| + | ** czfrmaseeptbaq-mycgwmctsa-n | ||
| + | * molecular-weight: | ||
| + | ** 685.084 | ||
| + | * smiles: | ||
| + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c=c(c=1)o)/oc) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}} | ||
| + | {{#set: molecular-weight=685.084}} | ||
Revision as of 17:03, 14 October 2022
Contents
Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE
- common-name:
- 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
- inchi-key:
- czfrmaseeptbaq-mycgwmctsa-n
- molecular-weight:
- 685.084
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c=c(c=1)o)/oc)
