Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Peptidoglycan-with-L-lysine-pentapeptide == * common-name: ** a peptidoglycan with (l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanin...") |
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * inchi-key: ** alynczndiqevrv-uhfffaoysa-m * molecular-weight: ** 136.13 * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite P-AMINO-BENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-aminobenzoate |
| + | * inchi-key: | ||
| + | ** alynczndiqevrv-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 136.13 | ||
| + | * smiles: | ||
| + | ** c(=o)([o-])c1(/c=cc(\n)=c/c=1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ExchangeSeed-P-AMINO-BENZOATE]] |
| + | * [[H2PTEROATESYNTH-RXN]] | ||
| + | * [[TransportSeed-P-AMINO-BENZOATE]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-P-AMINO-BENZOATE]] |
| + | * [[TransportSeed-P-AMINO-BENZOATE]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-aminobenzoate}} |
| + | {{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=136.13}} | ||
Revision as of 17:05, 14 October 2022
Contents
Metabolite P-AMINO-BENZOATE
- common-name:
- 4-aminobenzoate
- inchi-key:
- alynczndiqevrv-uhfffaoysa-m
- molecular-weight:
- 136.13
- smiles:
- c(=o)([o-])c1(/c=cc(\n)=c/c=1)
