Difference between revisions of "PROTON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-205 == * common-name: ** pimelate * inchi-key: ** wljvntcwhirura-uhfffaoysa-l * molecular-weight: ** 158.154 * smiles: ** c([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite DNA-containing-a-Apyrimidinic-Sites == * common-name: ** an apyrimidinic site in dna == Reaction(s) known to consume the compound == == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-205 ==
+
== Metabolite DNA-containing-a-Apyrimidinic-Sites ==
 
* common-name:
 
* common-name:
** pimelate
+
** an apyrimidinic site in dna
* inchi-key:
 
** wljvntcwhirura-uhfffaoysa-l
 
* molecular-weight:
 
** 158.154
 
* smiles:
 
** c([o-])(=o)cccccc([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6-CARBOXYHEXANOATE--COA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2584]]
 +
* [[RXN0-2601]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pimelate}}
+
{{#set: common-name=an apyrimidinic site in dna}}
{{#set: inchi-key=inchikey=wljvntcwhirura-uhfffaoysa-l}}
 
{{#set: molecular-weight=158.154}}
 

Revision as of 07:46, 17 October 2022

Metabolite DNA-containing-a-Apyrimidinic-Sites

  • common-name:
    • an apyrimidinic site in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality