Difference between revisions of "Charged-fMET-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-fMET-tRNAs == * common-name: ** an n-formyl-l-methionylaminoacyl-trna == Reaction(s) known to consume the compound == * 3.5.1.2...") |
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * inchi-key: ** lflucdosqpjjbe-uhfffaoysa-k * molecular-weight: ** 181.018...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-P-HYDROXYPYRUVATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phosphooxypyruvate |
+ | * inchi-key: | ||
+ | ** lflucdosqpjjbe-uhfffaoysa-k | ||
+ | * molecular-weight: | ||
+ | ** 181.018 | ||
+ | * smiles: | ||
+ | ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PGLYCDEHYDROG-RXN]] |
+ | * [[PSERTRANSAM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PGLYCDEHYDROG-RXN]] | ||
+ | * [[PSERTRANSAM-RXN]] | ||
+ | * [[RXN-17808]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phosphooxypyruvate}} |
+ | {{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}} | ||
+ | {{#set: molecular-weight=181.018}} |
Revision as of 07:46, 17 October 2022
Contents
Metabolite 3-P-HYDROXYPYRUVATE
- common-name:
- 3-phosphooxypyruvate
- inchi-key:
- lflucdosqpjjbe-uhfffaoysa-k
- molecular-weight:
- 181.018
- smiles:
- c(op([o-])(=o)[o-])c(=o)c(=o)[o-]