Difference between revisions of "DEHYDROQUINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-uridine34 == * common-name: ** a uridine34 in trna == Reaction(s) known to consume the compound == * RXN-16820 * RXN-18693 *...") |
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * inchi-key: ** oinneunvozhbox-qircyjposa-k * molecular-weight: ** 447....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GERANYLGERANYL-PP == |
* common-name: | * common-name: | ||
| − | ** | + | ** geranylgeranyl diphosphate |
| + | * inchi-key: | ||
| + | ** oinneunvozhbox-qircyjposa-k | ||
| + | * molecular-weight: | ||
| + | ** 447.424 | ||
| + | * smiles: | ||
| + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cop(=o)([o-])op(=o)([o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.5.1.41-RXN]] |
| − | * [[RXN- | + | * [[RXN-11458]] |
| − | * [[ | + | * [[RXN-8813]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[FARNESYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=geranylgeranyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}} | ||
| + | {{#set: molecular-weight=447.424}} | ||
Revision as of 07:49, 17 October 2022
Contents
Metabolite GERANYLGERANYL-PP
- common-name:
- geranylgeranyl diphosphate
- inchi-key:
- oinneunvozhbox-qircyjposa-k
- molecular-weight:
- 447.424
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cop(=o)([o-])op(=o)([o-])[o-]
