Difference between revisions of "NADPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINONE-6 == * common-name: ** ubiquinone-6 * inchi-key: ** gxnfpeoukfotky-lphqiwjtsa-n * molecular-weight: ** 590.885 * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite NADPH == * common-name: ** nadph * inchi-key: ** acfixjijdzmppo-nnyoxohssa-j * molecular-weight: ** 741.394 * smiles: ** c5(/n([c@h]1(o[c...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UBIQUINONE-6 ==
+
== Metabolite NADPH ==
 
* common-name:
 
* common-name:
** ubiquinone-6
+
** nadph
 
* inchi-key:
 
* inchi-key:
** gxnfpeoukfotky-lphqiwjtsa-n
+
** acfixjijdzmppo-nnyoxohssa-j
 
* molecular-weight:
 
* molecular-weight:
** 590.885
+
** 741.394
 
* smiles:
 
* smiles:
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o)
+
** c5(/n([c@h]1(o[c@@h]([c@h]([c@h]1o)o)cop(op(oc[c@h]4([c@h]([c@h]([c@h](n2(c3(n=cn=c(c(n=c2)=3)n)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(cc=5)c(=o)n)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.2.1.13-RXN]]
 +
* [[1.6.5.6-RXN]]
 +
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
 +
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 +
* [[ACETOLACTREDUCTOISOM-RXN]]
 +
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 +
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DIHYDROFOLATEREDUCT-RXN]]
 +
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[DXPREDISOM-RXN]]
 +
* [[ExchangeSeed-NADPH]]
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLUTRNAREDUCT-RXN]]
 +
* [[GLUTSEMIALDEHYDROG-RXN]]
 +
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 +
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 +
* [[RHEA_31103]]
 +
* [[RIBOFLAVINSYNREDUC-RXN]]
 +
* [[RXN-10060]]
 +
* [[RXN-10655]]
 +
* [[RXN-10659]]
 +
* [[RXN-11319]]
 +
* [[RXN-11476]]
 +
* [[RXN-11480]]
 +
* [[RXN-11566]]
 +
* [[RXN-12444]]
 +
* [[RXN-13008]]
 +
* [[RXN-13724]]
 +
* [[RXN-14246]]
 +
* [[RXN-15006]]
 +
* [[RXN-16616]]
 +
* [[RXN-16622]]
 +
* [[RXN-16626]]
 +
* [[RXN-16630]]
 +
* [[RXN-16765]]
 +
* [[RXN-18357]]
 +
* [[RXN-19329]]
 +
* [[RXN-20456]]
 +
* [[RXN-20457]]
 +
* [[RXN-8974]]
 +
* [[RXN-9514]]
 +
* [[RXN-9518]]
 +
* [[RXN-9524]]
 +
* [[RXN-9528]]
 +
* [[RXN-9532]]
 +
* [[RXN-9536]]
 +
* [[RXN-9540]]
 +
* [[RXN-9552]]
 +
* [[RXN-9556]]
 +
* [[RXN-9633]]
 +
* [[RXN-9951]]
 +
* [[RXN0-1281]]
 +
* [[RXN0-2142]]
 +
* [[RXN0-300]]
 +
* [[RXN0-4022]]
 +
* [[RXN0-4281]]
 +
* [[RXN0-6367]]
 +
* [[RXN1A0-6303]]
 +
* [[RXN1G-157]]
 +
* [[RXN1G-349]]
 +
* [[RXN1G-469]]
 +
* [[RXN1G-508]]
 +
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 +
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 +
* [[TransportSeed-NADPH]]
 +
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 +
* [[YIAE1-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.6.5.6-RXN]]
 +
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[DXPREDISOM-RXN]]
 +
* [[ExchangeSeed-NADPH]]
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[GLUCOSE-1-DEHYDROGENASE-NADP+-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[MALIC-NADP-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 +
* [[NADH-KINASE-RXN]]
 +
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[RHEA_31103]]
 +
* [[RXN-13141]]
 +
* [[RXN-14246]]
 +
* [[RXN-16001]]
 +
* [[RXN-9951]]
 +
* [[RXN0-3962]]
 +
* [[SUCCSEMIALDDEHYDROG-RXN]]
 +
* [[TransportSeed-NADPH]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinone-6}}
+
{{#set: common-name=nadph}}
{{#set: inchi-key=inchikey=gxnfpeoukfotky-lphqiwjtsa-n}}
+
{{#set: inchi-key=inchikey=acfixjijdzmppo-nnyoxohssa-j}}
{{#set: molecular-weight=590.885}}
+
{{#set: molecular-weight=741.394}}

Latest revision as of 11:12, 17 October 2022

Metabolite NADPH

  • common-name:
    • nadph
  • inchi-key:
    • acfixjijdzmppo-nnyoxohssa-j
  • molecular-weight:
    • 741.394
  • smiles:
    • c5(/n([c@h]1(o[c@@h]([c@h]([c@h]1o)o)cop(op(oc[c@h]4([c@h]([c@h]([c@h](n2(c3(n=cn=c(c(n=c2)=3)n)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(cc=5)c(=o)n)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality