Difference between revisions of "2-ACETO-LACTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FISUC_RS11380 == * common-name: ** lnt * transcription-direction: ** negative * centisome-position: ** 72.571686 * left-end-position: ** 2788665...")
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FISUC_RS11380 ==
+
== Metabolite 2-ACETO-LACTATE ==
 
* common-name:
 
* common-name:
−
** lnt
+
** (s)-2-acetolactate
−
* transcription-direction:
+
* inchi-key:
−
** negative
+
** nmdwgegfjubklb-yfkpbyrvsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 72.571686   
+
** 131.108
−
* left-end-position:
+
* smiles:
−
** 2788665
+
** cc(=o)[c@](c)(o)c(=o)[o-]
−
* right-end-position:
+
== Reaction(s) known to consume the compound ==
−
** 2790608
+
* [[ACETOLACTREDUCTOISOM-RXN]]
−
== Organism(s) associated with this gene  ==
+
* [[RXN-6081]]
−
* [[fibrobacter_final_03112020]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[ACETOLACTSYN-RXN]]
−
* [[RXN-17363]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(s)-2-acetolactate}}
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
−
* [[RXN-19774]]
+
{{#set: molecular-weight=131.108}}
−
** Category: [[annotation]]
 
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7884]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: common-name=lnt}}
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: centisome-position=72.571686    }}
 
−
{{#set: left-end-position=2788665}}
 
−
{{#set: right-end-position=2790608}}
 
−
{{#set: organism associated=fibrobacter_final_03112020}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 17 October 2022

Metabolite 2-ACETO-LACTATE

  • common-name:
    • (s)-2-acetolactate
  • inchi-key:
    • nmdwgegfjubklb-yfkpbyrvsa-m
  • molecular-weight:
    • 131.108
  • smiles:
    • cc(=o)[c@](c)(o)c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=2-ACETO-LACTATE&oldid=91283"