Difference between revisions of "2-ACETO-LACTATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene FSU_RS04325 == * transcription-direction: ** negative * centisome-position: ** 26.28566 * left-end-position: ** 1010159 * right-end-position: **...") |
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 2-ACETO-LACTATE == |
− | * | + | * common-name: |
− | ** | + | ** (s)-2-acetolactate |
− | * | + | * inchi-key: |
− | ** | + | ** nmdwgegfjubklb-yfkpbyrvsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 131.108 |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)[c@](c)(o)c(=o)[o-] |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[ACETOLACTREDUCTOISOM-RXN]] | |
− | == Reaction(s) | + | * [[RXN-6081]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[ACETOLACTSYN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | {{#set: common-name=(s)-2-acetolactate}} |
− | * [[ | + | {{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}} |
− | + | {{#set: molecular-weight=131.108}} | |
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: |
Latest revision as of 11:13, 17 October 2022
Contents
Metabolite 2-ACETO-LACTATE
- common-name:
- (s)-2-acetolactate
- inchi-key:
- nmdwgegfjubklb-yfkpbyrvsa-m
- molecular-weight:
- 131.108
- smiles:
- cc(=o)[c@](c)(o)c(=o)[o-]