Difference between revisions of "2-ACETO-LACTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-L-alanyl-Protein == * common-name: ** an n-terminal-l-methionyl-l-alanyl-[protein] == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-ACETO-LACTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-2-acetolactate |
| + | * inchi-key: | ||
| + | ** nmdwgegfjubklb-yfkpbyrvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 131.108 | ||
| + | * smiles: | ||
| + | ** cc(=o)[c@](c)(o)c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ACETOLACTREDUCTOISOM-RXN]] |
| + | * [[RXN-6081]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ACETOLACTSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-2-acetolactate}} |
| + | {{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}} | ||
| + | {{#set: molecular-weight=131.108}} | ||
Latest revision as of 11:13, 17 October 2022
Contents
Metabolite 2-ACETO-LACTATE
- common-name:
- (s)-2-acetolactate
- inchi-key:
- nmdwgegfjubklb-yfkpbyrvsa-m
- molecular-weight:
- 131.108
- smiles:
- cc(=o)[c@](c)(o)c(=o)[o-]
