Difference between revisions of "CPD0-2433"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * inchi-key: ** jazbehyotptenj-jlnkqsitsa-m * m...")
(Created page with "Category:metabolite == Metabolite CPD0-2433 == * common-name: ** dipotassium phosphate * molecular-weight: ** 174.17499 == Reaction(s) known to consume the compound == * [...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE ==
+
== Metabolite CPD0-2433 ==
 
* common-name:
 
* common-name:
** (5z,8z,11z,14z,17z)-icosapentaenoate
+
** dipotassium phosphate
* inchi-key:
 
** jazbehyotptenj-jlnkqsitsa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 301.448
+
** 174.17499
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12978]]
+
* [[ExchangeSeed-CPD0-2433]]
 +
* [[TransportSeed-CPD0-2433]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ExchangeSeed-CPD0-2433]]
 +
* [[TransportSeed-CPD0-2433]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}}
+
{{#set: common-name=dipotassium phosphate}}
{{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}}
+
{{#set: molecular-weight=174.17499}}
{{#set: molecular-weight=301.448}}
 

Latest revision as of 11:14, 17 October 2022

Metabolite CPD0-2433

  • common-name:
    • dipotassium phosphate
  • molecular-weight:
    • 174.17499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality