Difference between revisions of "1-AMINO-PROPAN-2-ONE-3-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINONE-6 == * common-name: ** ubiquinone-6 * inchi-key: ** gxnfpeoukfotky-lphqiwjtsa-n * molecular-weight: ** 590.885 * smiles: ** cc...")
 
(Created page with "Category:metabolite == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == * common-name: ** 3-amino-1-hydroxyacetone 1-phosphate * inchi-key: ** hiqnvodxenyofk-uhfffaoysa-m *...")
 
(15 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite UBIQUINONE-6 ==
+
== Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE ==
 
* common-name:
 
* common-name:
−
** ubiquinone-6
+
** 3-amino-1-hydroxyacetone 1-phosphate
 
* inchi-key:
 
* inchi-key:
−
** gxnfpeoukfotky-lphqiwjtsa-n
+
** hiqnvodxenyofk-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 590.885
+
** 168.066
 
* smiles:
 
* smiles:
−
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o)
+
** c(c(=o)c[n+])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]]
+
* [[PDXJ-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=ubiquinone-6}}
+
{{#set: common-name=3-amino-1-hydroxyacetone 1-phosphate}}
−
{{#set: inchi-key=inchikey=gxnfpeoukfotky-lphqiwjtsa-n}}
+
{{#set: inchi-key=inchikey=hiqnvodxenyofk-uhfffaoysa-m}}
−
{{#set: molecular-weight=590.885}}
+
{{#set: molecular-weight=168.066}}

Latest revision as of 11:14, 17 October 2022

Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE

  • common-name:
    • 3-amino-1-hydroxyacetone 1-phosphate
  • inchi-key:
    • hiqnvodxenyofk-uhfffaoysa-m
  • molecular-weight:
    • 168.066
  • smiles:
    • c(c(=o)c[n+])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=1-AMINO-PROPAN-2-ONE-3-PHOSPHATE&oldid=91747"