Difference between revisions of "1-AMINO-PROPAN-2-ONE-3-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Delta4-hexadecenoyl-ACPs == * common-name: ** a (4z)-hexadec-4-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-8391...") |
(Created page with "Category:metabolite == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == * common-name: ** 3-amino-1-hydroxyacetone 1-phosphate * inchi-key: ** hiqnvodxenyofk-uhfffaoysa-m *...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-amino-1-hydroxyacetone 1-phosphate |
+ | * inchi-key: | ||
+ | ** hiqnvodxenyofk-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 168.066 | ||
+ | * smiles: | ||
+ | ** c(c(=o)c[n+])op(=o)([o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[PDXJ-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-amino-1-hydroxyacetone 1-phosphate}} |
+ | {{#set: inchi-key=inchikey=hiqnvodxenyofk-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=168.066}} |
Latest revision as of 11:14, 17 October 2022
Contents
Metabolite 1-AMINO-PROPAN-2-ONE-3-PHOSPHATE
- common-name:
- 3-amino-1-hydroxyacetone 1-phosphate
- inchi-key:
- hiqnvodxenyofk-uhfffaoysa-m
- molecular-weight:
- 168.066
- smiles:
- c(c(=o)c[n+])op(=o)([o-])[o-]